2-pentanone, 5-nitro-
5-Nitro-2-pentanone
CAS: 22020-87-7
Molecular Formula: C5H9NO3
2-pentanone, 5-nitro- - Names and Identifiers
| Name | 5-Nitro-2-pentanone |
| Synonyms | 5-Nitro-2-pentanone 5-NITRO-2-PENTANONE 5-Nitropentan-2-one 2-Pentanone, 5-nitro- 2-pentanone, 5-nitro- 2-Pentanone, 5-nitro- (6CI,7CI,8CI,9CI) |
| CAS | 22020-87-7 |
| InChI | InChI=1/C5H9NO3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3 |
2-pentanone, 5-nitro- - Physico-chemical Properties
| Molecular Formula | C5H9NO3 |
| Molar Mass | 131.13 |
| Density | 1.084g/cm3 |
| Boling Point | 231.7°C at 760 mmHg |
| Flash Point | 105.4°C |
| Vapor Presure | 0.0614mmHg at 25°C |
| Refractive Index | 1.43 |
2-pentanone, 5-nitro- - Introduction
5-ntro-2-pentanone is an organic compound with the chemical formula C5H9NO3. Here are some of its properties and uses:
Nature:
-Appearance: Colorless to light yellow liquid
-Boiling point: 98-100 ° C
-Density: 1.22g/cm³
-Solubility: Soluble in water and organic solvents
Use:
1. 5-Nitro-2-pentanone is mainly used as an intermediate in the synthesis of organic compounds.
2. It can also be used for oxidation, reduction and catalytic reactions in organic synthesis reactions.
Method:
5-Nitro-2-pentanone can be synthesized by the following steps:
1. React 2-pentanone with nitric acid to generate 2-nitro -2-pentanone.
2. Nitration of the generated 2-nitro-2-pentanone to obtain 5-Nitro-2-pentanone.
Safety Information:
1. 5-Nitro-2-pentanone should be treated as a hazardous material, avoiding contact with skin, eyes and mucous membranes.
2. Wear appropriate personal protective equipment such as gloves, protective glasses and laboratory goggles during operation.
3. In storage and handling should be away from the fire and heat source, avoid contact with open flame and high temperature.
4. 5-Nitro-2-pentanone should be stored in a sealed container and placed in a cool and dry place.
5. In the event of a leak, immediately take appropriate measures to clean up and limit the spread, and comply with relevant environmental and safety regulations.
Nature:
-Appearance: Colorless to light yellow liquid
-Boiling point: 98-100 ° C
-Density: 1.22g/cm³
-Solubility: Soluble in water and organic solvents
Use:
1. 5-Nitro-2-pentanone is mainly used as an intermediate in the synthesis of organic compounds.
2. It can also be used for oxidation, reduction and catalytic reactions in organic synthesis reactions.
Method:
5-Nitro-2-pentanone can be synthesized by the following steps:
1. React 2-pentanone with nitric acid to generate 2-nitro -2-pentanone.
2. Nitration of the generated 2-nitro-2-pentanone to obtain 5-Nitro-2-pentanone.
Safety Information:
1. 5-Nitro-2-pentanone should be treated as a hazardous material, avoiding contact with skin, eyes and mucous membranes.
2. Wear appropriate personal protective equipment such as gloves, protective glasses and laboratory goggles during operation.
3. In storage and handling should be away from the fire and heat source, avoid contact with open flame and high temperature.
4. 5-Nitro-2-pentanone should be stored in a sealed container and placed in a cool and dry place.
5. In the event of a leak, immediately take appropriate measures to clean up and limit the spread, and comply with relevant environmental and safety regulations.
Last Update：2024-04-10 22:29:15
